C25H33N3O8S — CID 155234376
N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]phenyl]sulfonyl-6-(dimethylamino)-1-benzofuran-2-carboxamide (PubChem CID 155234376) has the molecular formula C25H33N3O8S and a molecular weight of 535.62 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]phenyl]sulfonyl-6-(dimethylamino)-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]phenyl]sulfonyl-6-(dimethylamino)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 155234376 |
| Molecular Formula | C25H33N3O8S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | N-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]phenyl]sulfonyl-6-(dimethylamino)-1-benzofuran-2-carboxamide |
| SMILES | CN(C)c1ccc2cc(C(=O)NS(=O)(=O)c3ccccc3OCCOCCOCCOCCN)oc2c1 |
| InChI | InChI=1S/C25H33N3O8S/c1-28(2)20-8-7-19-17-23(36-22(19)18-20)25(29)27-37(30,31)24-6-4-3-5-21(24)35-16-15-34-14-13-33-12-11-32-10-9-26/h3-8,17-18H,9-16,26H2,1-2H3,(H,27,29) |
| InChIKey | ORMVEIOHGNUMLB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 142.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|