C24H28IN3O7S — CID 155244963
(1-iodo-2-methylpropan-2-yl) N-[2-[2-[[6-(dimethylamino)-1-benzofuran-2-carbonyl]sulfamoyl]phenoxy]ethyl]carbamate (PubChem CID 155244963) has the molecular formula C24H28IN3O7S and a molecular weight of 629.47 g/mol. Its IUPAC name is (1-iodo-2-methylpropan-2-yl) N-[2-[2-[[6-(dimethylamino)-1-benzofuran-2-carbonyl]sulfamoyl]phenoxy]ethyl]carbamate.
| Compound Name | (1-iodo-2-methylpropan-2-yl) N-[2-[2-[[6-(dimethylamino)-1-benzofuran-2-carbonyl]sulfamoyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 155244963 |
| Molecular Formula | C24H28IN3O7S |
| Molecular Weight | 629.47 g/mol |
| Exact Mass | 629.07 |
| IUPAC Name | (1-iodo-2-methylpropan-2-yl) N-[2-[2-[[6-(dimethylamino)-1-benzofuran-2-carbonyl]sulfamoyl]phenoxy]ethyl]carbamate |
| SMILES | CN(C)c1ccc2cc(C(=O)NS(=O)(=O)c3ccccc3OCCNC(=O)OC(C)(C)CI)oc2c1 |
| InChI | InChI=1S/C24H28IN3O7S/c1-24(2,15-25)35-23(30)26-11-12-33-18-7-5-6-8-21(18)36(31,32)27-22(29)20-13-16-9-10-17(28(3)4)14-19(16)34-20/h5-10,13-14H,11-12,15H2,1-4H3,(H,26,30)(H,27,29) |
| InChIKey | DETXRDBLVPQTBN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|