C23H21N3O5S — CID 166596042
6-cyclopropyl-N-(2-ethoxyphenyl)sulfonyl-4-imidazol-1-yl-1-benzofuran-2-carboxamide (PubChem CID 166596042) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is 6-cyclopropyl-N-(2-ethoxyphenyl)sulfonyl-4-imidazol-1-yl-1-benzofuran-2-carboxamide.
| Compound Name | 6-cyclopropyl-N-(2-ethoxyphenyl)sulfonyl-4-imidazol-1-yl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 166596042 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 6-cyclopropyl-N-(2-ethoxyphenyl)sulfonyl-4-imidazol-1-yl-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccccc1S(=O)(=O)NC(=O)c1cc2c(-n3ccnc3)cc(C3CC3)cc2o1 |
| InChI | InChI=1S/C23H21N3O5S/c1-2-30-19-5-3-4-6-22(19)32(28,29)25-23(27)21-13-17-18(26-10-9-24-14-26)11-16(15-7-8-15)12-20(17)31-21/h3-6,9-15H,2,7-8H2,1H3,(H,25,27) |
| InChIKey | JHBOFPHQFLXHRU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |