C11H8ClFN2O4 — CID 167020392
ethyl 8-chloro-5-fluoro-4-hydroxy-2-oxo-1H-1,7-naphthyridine-3-carboxylate (PubChem CID 167020392) has the molecular formula C11H8ClFN2O4 and a molecular weight of 286.65 g/mol. Its IUPAC name is ethyl 8-chloro-5-fluoro-4-hydroxy-2-oxo-1H-1,7-naphthyridine-3-carboxylate.
| Compound Name | ethyl 8-chloro-5-fluoro-4-hydroxy-2-oxo-1H-1,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 167020392 |
| Molecular Formula | C11H8ClFN2O4 |
| Molecular Weight | 286.65 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | ethyl 8-chloro-5-fluoro-4-hydroxy-2-oxo-1H-1,7-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2c(F)cnc(Cl)c2[nH]c1=O |
| InChI | InChI=1S/C11H8ClFN2O4/c1-2-19-11(18)6-8(16)5-4(13)3-14-9(12)7(5)15-10(6)17/h3H,2H2,1H3,(H2,15,16,17) |
| InChIKey | JXSBPDDZNCKGTB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.65 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|