C34H37N5O3 — CID 167021339
2-[[4-[(2Z,4E)-5-(methylideneamino)-5-(quinolin-4-ylmethoxy)penta-2,4-dienyl]piperidin-1-yl]methyl]-3-(oxetan-2-ylmethyl)benzimidazole-5-carbaldehyde (PubChem CID 167021339) has the molecular formula C34H37N5O3 and a molecular weight of 563.70 g/mol. Its IUPAC name is 2-[[4-[(2Z,4E)-5-(methylideneamino)-5-(quinolin-4-ylmethoxy)penta-2,4-dienyl]piperidin-1-yl]methyl]-3-(oxetan-2-ylmethyl)benzimidazole-5-carbaldehyde.
| Compound Name | 2-[[4-[(2Z,4E)-5-(methylideneamino)-5-(quinolin-4-ylmethoxy)penta-2,4-dienyl]piperidin-1-yl]methyl]-3-(oxetan-2-ylmethyl)benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 167021339 |
| Molecular Formula | C34H37N5O3 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | 2-[[4-[(2Z,4E)-5-(methylideneamino)-5-(quinolin-4-ylmethoxy)penta-2,4-dienyl]piperidin-1-yl]methyl]-3-(oxetan-2-ylmethyl)benzimidazole-5-carbaldehyde |
| SMILES | C=N/C(=C\C=C/CC1CCN(Cc2nc3ccc(C=O)cc3n2CC2CCO2)CC1)OCc1ccnc2ccccc12 |
| InChI | InChI=1S/C34H37N5O3/c1-35-34(42-24-27-12-16-36-30-8-4-3-7-29(27)30)9-5-2-6-25-13-17-38(18-14-25)22-33-37-31-11-10-26(23-40)20-32(31)39(33)21-28-15-19-41-28/h2-5,7-12,16,20,23,25,28H,1,6,13-15,17-19,21-22,24H2/b5-2-,34-9+ |
| InChIKey | IDEOLSMNMWTDMR-UUXXJCGOSA-N |
| XLogP | 6.10 |
| TPSA | 81.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|