C19H22ClF3N4O2S — CID 167024184
1-[(2'R,6'S,7S)-2-chloro-2'-cyclopropyl-6'-(1-methyltriazol-4-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanol (PubChem CID 167024184) has the molecular formula C19H22ClF3N4O2S and a molecular weight of 462.93 g/mol. Its IUPAC name is 1-[(2'R,6'S,7S)-2-chloro-2'-cyclopropyl-6'-(1-methyltriazol-4-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[(2'R,6'S,7S)-2-chloro-2'-cyclopropyl-6'-(1-methyltriazol-4-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 167024184 |
| Molecular Formula | C19H22ClF3N4O2S |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1-[(2'R,6'S,7S)-2-chloro-2'-cyclopropyl-6'-(1-methyltriazol-4-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanol |
| SMILES | Cn1cc([C@@H]2C[C@]3(C[C@H](C4CC4)N2C(O)C(F)(F)F)OCCc2cc(Cl)sc23)nn1 |
| InChI | InChI=1S/C19H22ClF3N4O2S/c1-26-9-12(24-25-26)14-8-18(16-11(4-5-29-18)6-15(20)30-16)7-13(10-2-3-10)27(14)17(28)19(21,22)23/h6,9-10,13-14,17,28H,2-5,7-8H2,1H3/t13-,14+,17?,18+/m1/s1 |
| InChIKey | SLCODDFWRISKBV-JWISNHSZSA-N |
| XLogP | 3.79 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |