C14H15ClF3NO2S — CID 169140386
1-[(2'S,7R)-2-chloro-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone (PubChem CID 169140386) has the molecular formula C14H15ClF3NO2S and a molecular weight of 353.79 g/mol. Its IUPAC name is 1-[(2'S,7R)-2-chloro-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2'S,7R)-2-chloro-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 169140386 |
| Molecular Formula | C14H15ClF3NO2S |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 1-[(2'S,7R)-2-chloro-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
| SMILES | C[C@H]1C[C@@]2(CCN1C(=O)C(F)(F)F)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C14H15ClF3NO2S/c1-8-7-13(3-4-19(8)12(20)14(16,17)18)11-9(2-5-21-13)6-10(15)22-11/h6,8H,2-5,7H2,1H3/t8-,13+/m0/s1 |
| InChIKey | GLFKWOHMFMGWNV-ISVAXAHUSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |