C17H25ClN2OS — CID 164725960
1-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-N,N-dimethylcyclopropan-1-amine (PubChem CID 164725960) has the molecular formula C17H25ClN2OS and a molecular weight of 340.92 g/mol. Its IUPAC name is 1-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-N,N-dimethylcyclopropan-1-amine.
| Compound Name | 1-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-N,N-dimethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 164725960 |
| Molecular Formula | C17H25ClN2OS |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]-N,N-dimethylcyclopropan-1-amine |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](C3(N(C)C)CC3)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C17H25ClN2OS/c1-11-9-17(10-13(19-11)16(5-6-16)20(2)3)15-12(4-7-21-17)8-14(18)22-15/h8,11,13,19H,4-7,9-10H2,1-3H3/t11-,13-,17-/m0/s1 |
| InChIKey | WKCRPIPYUOQLSF-BNLOLNQZSA-N |
| XLogP | 3.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |