C16H19ClN4OS — CID 164725799
5-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]pyrimidin-2-amine (PubChem CID 164725799) has the molecular formula C16H19ClN4OS and a molecular weight of 350.88 g/mol. Its IUPAC name is 5-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]pyrimidin-2-amine.
| Compound Name | 5-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 164725799 |
| Molecular Formula | C16H19ClN4OS |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 5-[(2'S,6'S,7S)-2-chloro-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]pyrimidin-2-amine |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cnc(N)nc3)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C16H19ClN4OS/c1-9-5-16(14-10(2-3-22-16)4-13(17)23-14)6-12(21-9)11-7-19-15(18)20-8-11/h4,7-9,12,21H,2-3,5-6H2,1H3,(H2,18,19,20)/t9-,12-,16-/m0/s1 |
| InChIKey | YEUHWHZCADDWJZ-HCYDYPBKSA-N |
| XLogP | 3.05 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |