C17H20ClN3OS — CID 164726079
(2'S,6'S,7S)-2-chloro-2'-methyl-6'-(3-methylpyrazin-2-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164726079) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-2'-methyl-6'-(3-methylpyrazin-2-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-2'-methyl-6'-(3-methylpyrazin-2-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164726079 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-2'-methyl-6'-(3-methylpyrazin-2-yl)spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | Cc1nccnc1[C@@H]1C[C@]2(C[C@H](C)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C17H20ClN3OS/c1-10-8-17(16-12(3-6-22-17)7-14(18)23-16)9-13(21-10)15-11(2)19-4-5-20-15/h4-5,7,10,13,21H,3,6,8-9H2,1-2H3/t10-,13-,17-/m0/s1 |
| InChIKey | YRIZRTBYRQWNBE-SVKFGRERSA-N |
| XLogP | 3.78 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |