C16H17ClF3N3OS — CID 167024285
(2'S,6'S,7S)-2-chloro-2'-methyl-6'-[5-(trifluoromethyl)-1H-imidazol-2-yl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 167024285) has the molecular formula C16H17ClF3N3OS and a molecular weight of 391.85 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-2'-methyl-6'-[5-(trifluoromethyl)-1H-imidazol-2-yl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-2'-methyl-6'-[5-(trifluoromethyl)-1H-imidazol-2-yl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 167024285 |
| Molecular Formula | C16H17ClF3N3OS |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-2'-methyl-6'-[5-(trifluoromethyl)-1H-imidazol-2-yl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3ncc(C(F)(F)F)[nH]3)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C16H17ClF3N3OS/c1-8-5-15(13-9(2-3-24-15)4-12(17)25-13)6-10(22-8)14-21-7-11(23-14)16(18,19)20/h4,7-8,10,22H,2-3,5-6H2,1H3,(H,21,23)/t8-,10-,15-/m0/s1 |
| InChIKey | OLVGAWFDHAYPKJ-KPCOEVGBSA-N |
| XLogP | 4.42 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |