C18H18ClF3N2OS — CID 164725721
(2'S,6'S,7S)-2-chloro-2'-methyl-6'-[6-(trifluoromethyl)-3-pyridinyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 164725721) has the molecular formula C18H18ClF3N2OS and a molecular weight of 402.87 g/mol. Its IUPAC name is (2'S,6'S,7S)-2-chloro-2'-methyl-6'-[6-(trifluoromethyl)-3-pyridinyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,6'S,7S)-2-chloro-2'-methyl-6'-[6-(trifluoromethyl)-3-pyridinyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 164725721 |
| Molecular Formula | C18H18ClF3N2OS |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (2'S,6'S,7S)-2-chloro-2'-methyl-6'-[6-(trifluoromethyl)-3-pyridinyl]spiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3ccc(C(F)(F)F)nc3)N1)OCCc1cc(Cl)sc12 |
| InChI | InChI=1S/C18H18ClF3N2OS/c1-10-7-17(16-11(4-5-25-17)6-15(19)26-16)8-13(24-10)12-2-3-14(23-9-12)18(20,21)22/h2-3,6,9-10,13,24H,4-5,7-8H2,1H3/t10-,13-,17-/m0/s1 |
| InChIKey | KCACJNOXKFAXBY-SVKFGRERSA-N |
| XLogP | 5.10 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |