C19H27F2NO2S — CID 170128756
2-[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]cyclopentan-1-ol (PubChem CID 170128756) has the molecular formula C19H27F2NO2S and a molecular weight of 371.49 g/mol. Its IUPAC name is 2-[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]cyclopentan-1-ol.
| Compound Name | 2-[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 170128756 |
| Molecular Formula | C19H27F2NO2S |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]cyclopentan-1-ol |
| SMILES | C[C@H]1C[C@@]2(CCN1C1CCCC1O)OCCc1cc(CC(F)F)sc12 |
| InChI | InChI=1S/C19H27F2NO2S/c1-12-11-19(6-7-22(12)15-3-2-4-16(15)23)18-13(5-8-24-19)9-14(25-18)10-17(20)21/h9,12,15-17,23H,2-8,10-11H2,1H3/t12-,15?,16?,19+/m0/s1 |
| InChIKey | VDGFDDLVRLNQPL-OPXIUPAWSA-N |
| XLogP | 3.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |