C24H31F2N3O3S — CID 169140045
N-[3-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]cyclobutyl]-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 169140045) has the molecular formula C24H31F2N3O3S and a molecular weight of 479.59 g/mol. Its IUPAC name is N-[3-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]cyclobutyl]-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]cyclobutyl]-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 169140045 |
| Molecular Formula | C24H31F2N3O3S |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | N-[3-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]cyclobutyl]-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CC(CN3CC[C@]4(C[C@@H]3C)OCCc3cc(CC(F)F)sc34)C2)on1 |
| InChI | InChI=1S/C24H31F2N3O3S/c1-14-7-20(32-28-14)23(30)27-18-8-16(9-18)13-29-5-4-24(12-15(29)2)22-17(3-6-31-24)10-19(33-22)11-21(25)26/h7,10,15-16,18,21H,3-6,8-9,11-13H2,1-2H3,(H,27,30)/t15-,16?,18?,24+/m0/s1 |
| InChIKey | WKSIHAVOXQJRBE-CMZZWGOASA-N |
| XLogP | 4.31 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |