C19H26F2N2O2S — CID 170128849
5-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]pyrrolidin-2-one (PubChem CID 170128849) has the molecular formula C19H26F2N2O2S and a molecular weight of 384.49 g/mol. Its IUPAC name is 5-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]pyrrolidin-2-one.
| Compound Name | 5-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 170128849 |
| Molecular Formula | C19H26F2N2O2S |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 5-[[(2'S,7R)-2-(2,2-difluoroethyl)-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl]methyl]pyrrolidin-2-one |
| SMILES | C[C@H]1C[C@@]2(CCN1CC1CCC(=O)N1)OCCc1cc(CC(F)F)sc12 |
| InChI | InChI=1S/C19H26F2N2O2S/c1-12-10-19(5-6-23(12)11-14-2-3-17(24)22-14)18-13(4-7-25-19)8-15(26-18)9-16(20)21/h8,12,14,16H,2-7,9-11H2,1H3,(H,22,24)/t12-,14?,19+/m0/s1 |
| InChIKey | CJWBKAXKNAVCGC-BOKJEVAUSA-N |
| XLogP | 3.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |