C18H27NO2S — CID 170128414
2-[(2'S,4R)-2,2'-dimethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]cyclopentan-1-ol (PubChem CID 170128414) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is 2-[(2'S,4R)-2,2'-dimethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]cyclopentan-1-ol.
| Compound Name | 2-[(2'S,4R)-2,2'-dimethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 170128414 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-[(2'S,4R)-2,2'-dimethylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]cyclopentan-1-ol |
| SMILES | Cc1cc2c(s1)CCO[C@@]21CCN(C2CCCC2O)[C@@H](C)C1 |
| InChI | InChI=1S/C18H27NO2S/c1-12-11-18(7-8-19(12)15-4-3-5-16(15)20)14-10-13(2)22-17(14)6-9-21-18/h10,12,15-16,20H,3-9,11H2,1-2H3/t12-,15?,16?,18+/m0/s1 |
| InChIKey | OSZBEVDTPNPAQA-KVSNZIMCSA-N |
| XLogP | 3.22 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |