C17H23NOS — CID 169138702
(2'R)-2-ethyl-2'-methyl-1'-prop-2-ynylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] (PubChem CID 169138702) has the molecular formula C17H23NOS and a molecular weight of 289.44 g/mol. Its IUPAC name is (2'R)-2-ethyl-2'-methyl-1'-prop-2-ynylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine].
| Compound Name | (2'R)-2-ethyl-2'-methyl-1'-prop-2-ynylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
|---|---|
| PubChem CID | 169138702 |
| Molecular Formula | C17H23NOS |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (2'R)-2-ethyl-2'-methyl-1'-prop-2-ynylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
| SMILES | C#CCN1CCC2(C[C@H]1C)OCCc1sc(CC)cc12 |
| InChI | InChI=1S/C17H23NOS/c1-4-8-18-9-7-17(12-13(18)3)15-11-14(5-2)20-16(15)6-10-19-17/h1,11,13H,5-10,12H2,2-3H3/t13-,17?/m1/s1 |
| InChIKey | KKGPBGZTRFYFTM-FWJOYPJLSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|