C20H27N7OS — CID 169140662
(2'S,4R)-2-ethyl-2'-methyl-1'-[[1-(1H-1,2,4-triazol-5-ylmethyl)triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] (PubChem CID 169140662) has the molecular formula C20H27N7OS and a molecular weight of 413.55 g/mol. Its IUPAC name is (2'S,4R)-2-ethyl-2'-methyl-1'-[[1-(1H-1,2,4-triazol-5-ylmethyl)triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine].
| Compound Name | (2'S,4R)-2-ethyl-2'-methyl-1'-[[1-(1H-1,2,4-triazol-5-ylmethyl)triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
|---|---|
| PubChem CID | 169140662 |
| Molecular Formula | C20H27N7OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2'S,4R)-2-ethyl-2'-methyl-1'-[[1-(1H-1,2,4-triazol-5-ylmethyl)triazol-4-yl]methyl]spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(Cc2cn(Cc3ncn[nH]3)nn2)[C@@H](C)C1 |
| InChI | InChI=1S/C20H27N7OS/c1-3-16-8-17-18(29-16)4-7-28-20(17)5-6-26(14(2)9-20)10-15-11-27(25-23-15)12-19-21-13-22-24-19/h8,11,13-14H,3-7,9-10,12H2,1-2H3,(H,21,22,24)/t14-,20+/m0/s1 |
| InChIKey | JRSDTNOSZCMHDL-VBKZILBWSA-N |
| XLogP | 2.52 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |