C25H37N3O2S — CID 169140484
(3S)-3-[[5-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]-2-pyridinyl]amino]-2-methylbutan-2-ol (PubChem CID 169140484) has the molecular formula C25H37N3O2S and a molecular weight of 443.66 g/mol. Its IUPAC name is (3S)-3-[[5-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]-2-pyridinyl]amino]-2-methylbutan-2-ol.
| Compound Name | (3S)-3-[[5-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]-2-pyridinyl]amino]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 169140484 |
| Molecular Formula | C25H37N3O2S |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (3S)-3-[[5-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]-2-pyridinyl]amino]-2-methylbutan-2-ol |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(Cc2ccc(N[C@@H](C)C(C)(C)O)nc2)[C@@H](C)C1 |
| InChI | InChI=1S/C25H37N3O2S/c1-6-20-13-21-22(31-20)9-12-30-25(21)10-11-28(17(2)14-25)16-19-7-8-23(26-15-19)27-18(3)24(4,5)29/h7-8,13,15,17-18,29H,6,9-12,14,16H2,1-5H3,(H,26,27)/t17-,18-,25+/m0/s1 |
| InChIKey | MMXMQTDWCDNWPU-DPOKWSEZSA-N |
| XLogP | 4.73 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |