C40H39N3O6 — CID 167031141
[(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10-hexaen-7-yl] 1-benzhydrylpyrrolidine-2-carboxylate (PubChem CID 167031141) has the molecular formula C40H39N3O6 and a molecular weight of 657.77 g/mol. Its IUPAC name is [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10-hexaen-7-yl] 1-benzhydrylpyrrolidine-2-carboxylate.
| Compound Name | [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10-hexaen-7-yl] 1-benzhydrylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 167031141 |
| Molecular Formula | C40H39N3O6 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10-hexaen-7-yl] 1-benzhydrylpyrrolidine-2-carboxylate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)C4CCCN4C(c4ccccc4)c4ccccc4)cc13)C1=CC3C(COC(=O)[C@]3(O)CC)C(=O)N1C2 |
| InChI | InChI=1S/C40H39N3O6/c1-3-27-28-20-26(49-38(45)33-16-11-19-42(33)36(24-12-7-5-8-13-24)25-14-9-6-10-15-25)17-18-32(28)41-35-29(27)22-43-34(35)21-31-30(37(43)44)23-48-39(46)40(31,47)4-2/h5-10,12-15,17-18,20-21,30-31,33,36,47H,3-4,11,16,19,22-23H2,1-2H3/t30?,31?,33?,40-/m0/s1 |
| InChIKey | WZDRSLHWVPAWPU-OKAVMBCVSA-N |
| XLogP | 5.58 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|