C27H30N2O6 — CID 134482510
tert-butyl [(19S)-10,19-diethyl-19-hydroxy-18-oxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate (PubChem CID 134482510) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is tert-butyl [(19S)-10,19-diethyl-19-hydroxy-18-oxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate.
| Compound Name | tert-butyl [(19S)-10,19-diethyl-19-hydroxy-18-oxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate |
|---|---|
| PubChem CID | 134482510 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | tert-butyl [(19S)-10,19-diethyl-19-hydroxy-18-oxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)OC(C)(C)C)cc13)C1=CC3=C(COC(=O)[C@]3(O)CC)CN1C2 |
| InChI | InChI=1S/C27H30N2O6/c1-6-17-18-10-16(34-25(31)35-26(3,4)5)8-9-21(18)28-23-19(17)13-29-12-15-14-33-24(30)27(32,7-2)20(15)11-22(23)29/h8-11,32H,6-7,12-14H2,1-5H3/t27-/m0/s1 |
| InChIKey | KHTHYRBCRFXDPV-MHZLTWQESA-N |
| XLogP | 4.28 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|