C29H32N4O6 — CID 118478582
[(19S)-10,19-diethyl-19-hydroxy-18-oxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] N-[2-(2-methylprop-2-enoylamino)ethyl]carbamate (PubChem CID 118478582) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is [(19S)-10,19-diethyl-19-hydroxy-18-oxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] N-[2-(2-methylprop-2-enoylamino)ethyl]carbamate.
| Compound Name | [(19S)-10,19-diethyl-19-hydroxy-18-oxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] N-[2-(2-methylprop-2-enoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 118478582 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | [(19S)-10,19-diethyl-19-hydroxy-18-oxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] N-[2-(2-methylprop-2-enoylamino)ethyl]carbamate |
| SMILES | C=C(C)C(=O)NCCNC(=O)Oc1ccc2nc3c(c(CC)c2c1)CN1CC2=C(C=C31)[C@@](O)(CC)C(=O)OC2 |
| InChI | InChI=1S/C29H32N4O6/c1-5-19-20-11-18(39-28(36)31-10-9-30-26(34)16(3)4)7-8-23(20)32-25-21(19)14-33-13-17-15-38-27(35)29(37,6-2)22(17)12-24(25)33/h7-8,11-12,37H,3,5-6,9-10,13-15H2,1-2,4H3,(H,30,34)(H,31,36)/t29-/m0/s1 |
| InChIKey | HEDVGYDXPBVPIO-LJAQVGFWSA-N |
| XLogP | 2.74 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|