C27H32N2O4 — CID 175715904
tert-butyl [(19S)-10,19-diethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate (PubChem CID 175715904) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl [(19S)-10,19-diethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate.
| Compound Name | tert-butyl [(19S)-10,19-diethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate |
|---|---|
| PubChem CID | 175715904 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | tert-butyl [(19S)-10,19-diethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] carbonate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)OC(C)(C)C)cc13)C1=CC3=C(COC[C@H]3CC)CN1C2 |
| InChI | InChI=1S/C27H32N2O4/c1-6-16-14-31-15-17-12-29-13-22-19(7-2)21-10-18(32-26(30)33-27(3,4)5)8-9-23(21)28-25(22)24(29)11-20(16)17/h8-11,16H,6-7,12-15H2,1-5H3/t16-/m1/s1 |
| InChIKey | JMOGCNFAQYLIPB-MRXNPFEDSA-N |
| XLogP | 5.63 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|