C32H37N3O3 — CID 162730967
[10-ethyl-19-[2-(methylamino)-2-oxoethyl]-14,18-dimethylidene-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 3,3-dimethylbutanoate (PubChem CID 162730967) has the molecular formula C32H37N3O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is [10-ethyl-19-[2-(methylamino)-2-oxoethyl]-14,18-dimethylidene-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 3,3-dimethylbutanoate.
| Compound Name | [10-ethyl-19-[2-(methylamino)-2-oxoethyl]-14,18-dimethylidene-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 162730967 |
| Molecular Formula | C32H37N3O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | [10-ethyl-19-[2-(methylamino)-2-oxoethyl]-14,18-dimethylidene-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 3,3-dimethylbutanoate |
| SMILES | C=C1CCC2=C(C=C3c4nc5ccc(OC(=O)CC(C)(C)C)cc5c(CC)c4CN3C2=C)C1CC(=O)NC |
| InChI | InChI=1S/C32H37N3O3/c1-8-21-25-13-20(38-30(37)16-32(4,5)6)10-12-27(25)34-31-26(21)17-35-19(3)22-11-9-18(2)23(15-29(36)33-7)24(22)14-28(31)35/h10,12-14,23H,2-3,8-9,11,15-17H2,1,4-7H3,(H,33,36) |
| InChIKey | OKARDICSIOPFEB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|