C26H25N3O4 — CID 162730985
3-[(10-ethyl-7-hydroxy-14,18-dimethylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]but-3-enamide (PubChem CID 162730985) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-[(10-ethyl-7-hydroxy-14,18-dimethylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]but-3-enamide.
| Compound Name | 3-[(10-ethyl-7-hydroxy-14,18-dimethylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]but-3-enamide |
|---|---|
| PubChem CID | 162730985 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-[(10-ethyl-7-hydroxy-14,18-dimethylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]but-3-enamide |
| SMILES | C=C(CC(N)=O)OC1C(=C)OCC2=C1C=C1c3nc4ccc(O)cc4c(CC)c3CN1C2=C |
| InChI | InChI=1S/C26H25N3O4/c1-5-17-18-9-16(30)6-7-22(18)28-25-20(17)11-29-14(3)21-12-32-15(4)26(19(21)10-23(25)29)33-13(2)8-24(27)31/h6-7,9-10,26,30H,2-5,8,11-12H2,1H3,(H2,27,31) |
| InChIKey | HVWZDIYSBOHQKE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|