C20H16N2O5 — CID 163992612
10-ethyl-7,14-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-18,19-dione (PubChem CID 163992612) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 10-ethyl-7,14-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-18,19-dione.
| Compound Name | 10-ethyl-7,14-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-18,19-dione |
|---|---|
| PubChem CID | 163992612 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 10-ethyl-7,14-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-18,19-dione |
| SMILES | CCc1c2c(nc3ccc(O)cc13)C1=CC3=C(COC(=O)C3=O)C(O)N1C2 |
| InChI | InChI=1S/C20H16N2O5/c1-2-10-11-5-9(23)3-4-15(11)21-17-13(10)7-22-16(17)6-12-14(19(22)25)8-27-20(26)18(12)24/h3-6,19,23,25H,2,7-8H2,1H3 |
| InChIKey | UBYOPXLLZGNXEM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|