About 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol
7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol (PubChem CID 143199333) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol.
Molecular Properties
| Compound Name | 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol |
| PubChem CID | 143199333 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol |
| SMILES | CCc1c2c(nc3ccc(N=O)cc13)-c1ccc(O)cc1OC2 |
| InChI | InChI=1S/C18H14N2O3/c1-2-12-14-7-10(20-22)3-6-16(14)19-18-13-5-4-11(21)8-17(13)23-9-15(12)18/h3-8,21H,2,9H2,1H3 |
| InChIKey | BOQAALRDEUZRDT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol?
The IUPAC name of 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol (CID 143199333) is 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol.
What is the SMILES notation for 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol?
The canonical SMILES for 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol is CCc1c2c(nc3ccc(N=O)cc13)-c1ccc(O)cc1OC2.
What is the InChIKey of 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol?
The InChIKey is BOQAALRDEUZRDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3/c1-2-12-14-7-10(20-22)3-6-16(14)19-18-13-5-4-11(21)8-17(13)23-9-15(12)18/h3-8,21H,2,9H2,1H3.
What are the key properties of 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol?
7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol has a molecular weight of 306.32 g/mol, XLogP of 4.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol is sourced from PubChem (CID 143199333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).