C18H14N2O3 — CID 143199333
7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol (PubChem CID 143199333) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol.
| Compound Name | 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol |
|---|---|
| PubChem CID | 143199333 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 7-ethyl-9-nitroso-6H-chromeno[4,3-b]quinolin-3-ol |
| SMILES | CCc1c2c(nc3ccc(N=O)cc13)-c1ccc(O)cc1OC2 |
| InChI | InChI=1S/C18H14N2O3/c1-2-12-14-7-10(20-22)3-6-16(14)19-18-13-5-4-11(21)8-17(13)23-9-15(12)18/h3-8,21H,2,9H2,1H3 |
| InChIKey | BOQAALRDEUZRDT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |