C28H31N3O4 — CID 162730984
ethane;3-[(10-ethyl-7-hydroxy-14,18-dimethylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]but-3-enamide (PubChem CID 162730984) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is ethane;3-[(10-ethyl-7-hydroxy-14,18-dimethylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]but-3-enamide.
| Compound Name | ethane;3-[(10-ethyl-7-hydroxy-14,18-dimethylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]but-3-enamide |
|---|---|
| PubChem CID | 162730984 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | ethane;3-[(10-ethyl-7-hydroxy-14,18-dimethylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl)oxy]but-3-enamide |
| SMILES | C=C(CC(N)=O)OC1C(=C)OCC2=C1C=C1c3nc4ccc(O)cc4c(CC)c3CN1C2=C.CC |
| InChI | InChI=1S/C26H25N3O4.C2H6/c1-5-17-18-9-16(30)6-7-22(18)28-25-20(17)11-29-14(3)21-12-32-15(4)26(19(21)10-23(25)29)33-13(2)8-24(27)31;1-2/h6-7,9-10,26,30H,2-5,8,11-12H2,1H3,(H2,27,31);1-2H3 |
| InChIKey | LKCCMULLXVGCNY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|