C33H33N3O10 — CID 138526321
tert-butyl [12-ethyl-8-(hydroxymethyl)-7-[1-(4-nitrophenoxy)carbonyloxypropyl]-9-oxo-11H-indolizino[1,2-b]quinolin-2-yl] carbonate (PubChem CID 138526321) has the molecular formula C33H33N3O10 and a molecular weight of 631.64 g/mol. Its IUPAC name is tert-butyl [12-ethyl-8-(hydroxymethyl)-7-[1-(4-nitrophenoxy)carbonyloxypropyl]-9-oxo-11H-indolizino[1,2-b]quinolin-2-yl] carbonate.
| Compound Name | tert-butyl [12-ethyl-8-(hydroxymethyl)-7-[1-(4-nitrophenoxy)carbonyloxypropyl]-9-oxo-11H-indolizino[1,2-b]quinolin-2-yl] carbonate |
|---|---|
| PubChem CID | 138526321 |
| Molecular Formula | C33H33N3O10 |
| Molecular Weight | 631.64 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | tert-butyl [12-ethyl-8-(hydroxymethyl)-7-[1-(4-nitrophenoxy)carbonyloxypropyl]-9-oxo-11H-indolizino[1,2-b]quinolin-2-yl] carbonate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)OC(C)(C)C)cc13)-c1cc(C(CC)OC(=O)Oc3ccc([N+](=O)[O-])cc3)c(CO)c(=O)n1C2 |
| InChI | InChI=1S/C33H33N3O10/c1-6-21-22-14-20(44-32(40)46-33(3,4)5)12-13-26(22)34-29-24(21)16-35-27(29)15-23(25(17-37)30(35)38)28(7-2)45-31(39)43-19-10-8-18(9-11-19)36(41)42/h8-15,28,37H,6-7,16-17H2,1-5H3 |
| InChIKey | YMFMUKZWGQGFDL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 169.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|