C37H32N3O11P — CID 126628405
[10,19-diethyl-19-[methyl(phenylmethoxy)phosphoryl]oxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] (4-nitrophenyl) carbonate (PubChem CID 126628405) has the molecular formula C37H32N3O11P and a molecular weight of 725.65 g/mol. Its IUPAC name is [10,19-diethyl-19-[methyl(phenylmethoxy)phosphoryl]oxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] (4-nitrophenyl) carbonate.
| Compound Name | [10,19-diethyl-19-[methyl(phenylmethoxy)phosphoryl]oxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 126628405 |
| Molecular Formula | C37H32N3O11P |
| Molecular Weight | 725.65 g/mol |
| Exact Mass | 725.18 |
| IUPAC Name | [10,19-diethyl-19-[methyl(phenylmethoxy)phosphoryl]oxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] (4-nitrophenyl) carbonate |
| SMILES | CCc1c2c(nc3ccc(OC(=O)Oc4ccc([N+](=O)[O-])cc4)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(CC)OP(C)(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H32N3O11P/c1-4-26-27-17-25(50-36(43)49-24-13-11-23(12-14-24)40(44)45)15-16-31(27)38-33-28(26)19-39-32(33)18-30-29(34(39)41)21-47-35(42)37(30,5-2)51-52(3,46)48-20-22-9-7-6-8-10-22/h6-18H,4-5,19-21H2,1-3H3 |
| InChIKey | DGDGTTOFDWVVFJ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 175.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.65 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|