About pentapropoxy-λ5-stibane
pentapropoxy-λ5-stibane (PubChem CID 16703362) has the molecular formula C15H35O5Sb
and a molecular weight of 417.20 g/mol. Its IUPAC name is pentapropoxy-λ5-stibane.
Molecular Properties
| Compound Name | pentapropoxy-λ5-stibane |
| PubChem CID | 16703362 |
| Molecular Formula | C15H35O5Sb |
| Molecular Weight | 417.20 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | pentapropoxy-λ5-stibane |
| SMILES | CCCO[Sb](OCCC)(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/5C3H7O.Sb/c5*1-2-3-4;/h5*2-3H2,1H3;/q5*-1;+5 |
| InChIKey | KAVYQAKABKLRHZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze pentapropoxy-λ5-stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentapropoxy-λ5-stibane?
The IUPAC name of pentapropoxy-λ5-stibane (CID 16703362) is pentapropoxy-λ5-stibane.
What is the SMILES notation for pentapropoxy-λ5-stibane?
The canonical SMILES for pentapropoxy-λ5-stibane is CCCO[Sb](OCCC)(OCCC)(OCCC)OCCC.
What is the InChIKey of pentapropoxy-λ5-stibane?
The InChIKey is KAVYQAKABKLRHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/5C3H7O.Sb/c5*1-2-3-4;/h5*2-3H2,1H3;/q5*-1;+5.
What are the key properties of pentapropoxy-λ5-stibane?
pentapropoxy-λ5-stibane has a molecular weight of 417.20 g/mol, XLogP of 4.01, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentapropoxy-λ5-stibane is sourced from PubChem (CID 16703362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).