About dipropoxyboranyl dipropyl borate
dipropoxyboranyl dipropyl borate (PubChem CID 141350690) has the molecular formula C12H28B2O5
and a molecular weight of 273.97 g/mol. Its IUPAC name is dipropoxyboranyl dipropyl borate.
Molecular Properties
| Compound Name | dipropoxyboranyl dipropyl borate |
| PubChem CID | 141350690 |
| Molecular Formula | C12H28B2O5 |
| Molecular Weight | 273.97 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | dipropoxyboranyl dipropyl borate |
| SMILES | CCCOB(OCCC)OB(OCCC)OCCC |
| InChI | InChI=1S/C12H28B2O5/c1-5-9-15-13(16-10-6-2)19-14(17-11-7-3)18-12-8-4/h5-12H2,1-4H3 |
| InChIKey | FJLWIYWWPOXKAK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.97 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dipropoxyboranyl dipropyl borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropoxyboranyl dipropyl borate?
The IUPAC name of dipropoxyboranyl dipropyl borate (CID 141350690) is dipropoxyboranyl dipropyl borate.
What is the SMILES notation for dipropoxyboranyl dipropyl borate?
The canonical SMILES for dipropoxyboranyl dipropyl borate is CCCOB(OCCC)OB(OCCC)OCCC.
What is the InChIKey of dipropoxyboranyl dipropyl borate?
The InChIKey is FJLWIYWWPOXKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28B2O5/c1-5-9-15-13(16-10-6-2)19-14(17-11-7-3)18-12-8-4/h5-12H2,1-4H3.
What are the key properties of dipropoxyboranyl dipropyl borate?
dipropoxyboranyl dipropyl borate has a molecular weight of 273.97 g/mol, XLogP of 2.68, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropoxyboranyl dipropyl borate is sourced from PubChem (CID 141350690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).