About cyanomethyl dipropyl borate
cyanomethyl dipropyl borate (PubChem CID 151454429) has the molecular formula C8H16BNO3
and a molecular weight of 185.03 g/mol. Its IUPAC name is cyanomethyl dipropyl borate.
Molecular Properties
| Compound Name | cyanomethyl dipropyl borate |
| PubChem CID | 151454429 |
| Molecular Formula | C8H16BNO3 |
| Molecular Weight | 185.03 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | cyanomethyl dipropyl borate |
| SMILES | CCCOB(OCC#N)OCCC |
| InChI | InChI=1S/C8H16BNO3/c1-3-6-11-9(12-7-4-2)13-8-5-10/h3-4,6-8H2,1-2H3 |
| InChIKey | PHDMZNUFLHSICL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.03 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyanomethyl dipropyl borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl dipropyl borate?
The IUPAC name of cyanomethyl dipropyl borate (CID 151454429) is cyanomethyl dipropyl borate.
What is the SMILES notation for cyanomethyl dipropyl borate?
The canonical SMILES for cyanomethyl dipropyl borate is CCCOB(OCC#N)OCCC.
What is the InChIKey of cyanomethyl dipropyl borate?
The InChIKey is PHDMZNUFLHSICL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16BNO3/c1-3-6-11-9(12-7-4-2)13-8-5-10/h3-4,6-8H2,1-2H3.
What are the key properties of cyanomethyl dipropyl borate?
cyanomethyl dipropyl borate has a molecular weight of 185.03 g/mol, XLogP of 1.36, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl dipropyl borate is sourced from PubChem (CID 151454429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).