About triethyl borate;hydrate
triethyl borate;hydrate (PubChem CID 141236748) has the molecular formula C6H17BO4
and a molecular weight of 164.01 g/mol. Its IUPAC name is triethyl borate;hydrate.
Molecular Properties
| Compound Name | triethyl borate;hydrate |
| PubChem CID | 141236748 |
| Molecular Formula | C6H17BO4 |
| Molecular Weight | 164.01 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | triethyl borate;hydrate |
| SMILES | CCOB(OCC)OCC.O |
| InChI | InChI=1S/C6H15BO3.H2O/c1-4-8-7(9-5-2)10-6-3;/h4-6H2,1-3H3;1H2 |
| InChIKey | UJSCNYYYFSWUCV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.01 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl borate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl borate;hydrate?
The IUPAC name of triethyl borate;hydrate (CID 141236748) is triethyl borate;hydrate.
What is the SMILES notation for triethyl borate;hydrate?
The canonical SMILES for triethyl borate;hydrate is CCOB(OCC)OCC.O.
What is the InChIKey of triethyl borate;hydrate?
The InChIKey is UJSCNYYYFSWUCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BO3.H2O/c1-4-8-7(9-5-2)10-6-3;/h4-6H2,1-3H3;1H2.
What are the key properties of triethyl borate;hydrate?
triethyl borate;hydrate has a molecular weight of 164.01 g/mol, XLogP of 0.26, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl borate;hydrate is sourced from PubChem (CID 141236748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).