About ditert-butyl ethyl borate
ditert-butyl ethyl borate (PubChem CID 174586427) has the molecular formula C10H23BO3
and a molecular weight of 202.10 g/mol. Its IUPAC name is ditert-butyl ethyl borate.
Molecular Properties
| Compound Name | ditert-butyl ethyl borate |
| PubChem CID | 174586427 |
| Molecular Formula | C10H23BO3 |
| Molecular Weight | 202.10 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | ditert-butyl ethyl borate |
| SMILES | CCOB(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C10H23BO3/c1-8-12-11(13-9(2,3)4)14-10(5,6)7/h8H2,1-7H3 |
| InChIKey | KFGGZQJDUPUUQP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.10 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl ethyl borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl ethyl borate?
The IUPAC name of ditert-butyl ethyl borate (CID 174586427) is ditert-butyl ethyl borate.
What is the SMILES notation for ditert-butyl ethyl borate?
The canonical SMILES for ditert-butyl ethyl borate is CCOB(OC(C)(C)C)OC(C)(C)C.
What is the InChIKey of ditert-butyl ethyl borate?
The InChIKey is KFGGZQJDUPUUQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23BO3/c1-8-12-11(13-9(2,3)4)14-10(5,6)7/h8H2,1-7H3.
What are the key properties of ditert-butyl ethyl borate?
ditert-butyl ethyl borate has a molecular weight of 202.10 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl ethyl borate is sourced from PubChem (CID 174586427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).