About triethyl borate;bis(trimethylsilane)
triethyl borate;bis(trimethylsilane) (PubChem CID 175760851) has the molecular formula C12H35BO3Si2
and a molecular weight of 294.39 g/mol. Its IUPAC name is triethyl borate;bis(trimethylsilane).
Molecular Properties
| Compound Name | triethyl borate;bis(trimethylsilane) |
| PubChem CID | 175760851 |
| Molecular Formula | C12H35BO3Si2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | triethyl borate;bis(trimethylsilane) |
| SMILES | CCOB(OCC)OCC.C[SiH](C)C.C[SiH](C)C |
| InChI | InChI=1S/C6H15BO3.2C3H10Si/c1-4-8-7(9-5-2)10-6-3;2*1-4(2)3/h4-6H2,1-3H3;2*4H,1-3H3 |
| InChIKey | PVJUCSMEBBUITL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethyl borate;bis(trimethylsilane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl borate;bis(trimethylsilane)?
The IUPAC name of triethyl borate;bis(trimethylsilane) (CID 175760851) is triethyl borate;bis(trimethylsilane).
What is the SMILES notation for triethyl borate;bis(trimethylsilane)?
The canonical SMILES for triethyl borate;bis(trimethylsilane) is CCOB(OCC)OCC.C[SiH](C)C.C[SiH](C)C.
What is the InChIKey of triethyl borate;bis(trimethylsilane)?
The InChIKey is PVJUCSMEBBUITL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BO3.2C3H10Si/c1-4-8-7(9-5-2)10-6-3;2*1-4(2)3/h4-6H2,1-3H3;2*4H,1-3H3.
What are the key properties of triethyl borate;bis(trimethylsilane)?
triethyl borate;bis(trimethylsilane) has a molecular weight of 294.39 g/mol, XLogP of 3.29, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl borate;bis(trimethylsilane) is sourced from PubChem (CID 175760851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).