C24H33N3O3 — CID 167033721
tert-butyl (2S)-2-[4-[2-(oxan-2-yl)pyrazol-3-yl]phenyl]piperidine-1-carboxylate (PubChem CID 167033721) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-[2-(oxan-2-yl)pyrazol-3-yl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-[2-(oxan-2-yl)pyrazol-3-yl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167033721 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | tert-butyl (2S)-2-[4-[2-(oxan-2-yl)pyrazol-3-yl]phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1c1ccc(-c2ccnn2C2CCCCO2)cc1 |
| InChI | InChI=1S/C24H33N3O3/c1-24(2,3)30-23(28)26-16-6-4-8-20(26)18-10-12-19(13-11-18)21-14-15-25-27(21)22-9-5-7-17-29-22/h10-15,20,22H,4-9,16-17H2,1-3H3/t20-,22?/m0/s1 |
| InChIKey | COYGJWYCFFDWAF-AIBWNMTMSA-N |
| XLogP | 5.71 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |