C20H15ClN4O3 — CID 167034535
2-[5-chloro-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyridin-3-yl]-3-methoxyphenol (PubChem CID 167034535) has the molecular formula C20H15ClN4O3 and a molecular weight of 394.82 g/mol. Its IUPAC name is 2-[5-chloro-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyridin-3-yl]-3-methoxyphenol.
| Compound Name | 2-[5-chloro-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyridin-3-yl]-3-methoxyphenol |
|---|---|
| PubChem CID | 167034535 |
| Molecular Formula | C20H15ClN4O3 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[5-chloro-2-(6-ethoxy-2-pyridinyl)imidazo[4,5-b]pyridin-3-yl]-3-methoxyphenol |
| SMILES | CCOC1=NC(c2nc3ccc(Cl)nc3n2-c2c(O)cccc2OC)=C=C=C1 |
| InChI | InChI=1S/C20H15ClN4O3/c1-3-28-17-9-4-6-12(22-17)19-23-13-10-11-16(21)24-20(13)25(19)18-14(26)7-5-8-15(18)27-2/h5,7-11,26H,3H2,1-2H3 |
| InChIKey | BHUFBVAYYAYAOE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|