C27H19N5O3 — CID 167034149
2-[2-(6-ethoxy-2-pyridinyl)-5-(2-phenylethynyl)imidazo[4,5-b]pyrazin-3-yl]-3-methoxyphenol (PubChem CID 167034149) has the molecular formula C27H19N5O3 and a molecular weight of 461.48 g/mol. Its IUPAC name is 2-[2-(6-ethoxy-2-pyridinyl)-5-(2-phenylethynyl)imidazo[4,5-b]pyrazin-3-yl]-3-methoxyphenol.
| Compound Name | 2-[2-(6-ethoxy-2-pyridinyl)-5-(2-phenylethynyl)imidazo[4,5-b]pyrazin-3-yl]-3-methoxyphenol |
|---|---|
| PubChem CID | 167034149 |
| Molecular Formula | C27H19N5O3 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-[2-(6-ethoxy-2-pyridinyl)-5-(2-phenylethynyl)imidazo[4,5-b]pyrazin-3-yl]-3-methoxyphenol |
| SMILES | CCOC1=NC(c2nc3ncc(C#Cc4ccccc4)nc3n2-c2c(O)cccc2OC)=C=C=C1 |
| InChI | InChI=1S/C27H19N5O3/c1-3-35-23-14-7-11-20(30-23)26-31-25-27(32(26)24-21(33)12-8-13-22(24)34-2)29-19(17-28-25)16-15-18-9-5-4-6-10-18/h4-6,8-10,12-14,17,33H,3H2,1-2H3 |
| InChIKey | CPIPEDAYUNEBOA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|