C18H23N3O2 — CID 167035571
1-[(1Z)-1-(3,4-dimethoxyphenyl)-4-methylpenta-1,3-dienyl]-5-methylpyrazol-3-amine (PubChem CID 167035571) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[(1Z)-1-(3,4-dimethoxyphenyl)-4-methylpenta-1,3-dienyl]-5-methylpyrazol-3-amine.
| Compound Name | 1-[(1Z)-1-(3,4-dimethoxyphenyl)-4-methylpenta-1,3-dienyl]-5-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 167035571 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[(1Z)-1-(3,4-dimethoxyphenyl)-4-methylpenta-1,3-dienyl]-5-methylpyrazol-3-amine |
| SMILES | COc1ccc(/C(=C/C=C(C)C)n2nc(N)cc2C)cc1OC |
| InChI | InChI=1S/C18H23N3O2/c1-12(2)6-8-15(21-13(3)10-18(19)20-21)14-7-9-16(22-4)17(11-14)23-5/h6-11H,1-5H3,(H2,19,20)/b15-8- |
| InChIKey | QTWXMQBINACGHU-NVNXTCNLSA-N |
| XLogP | 3.65 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|