C9H15NS — CID 167036996
2-methyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyridine-1-thione (PubChem CID 167036996) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 2-methyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyridine-1-thione.
| Compound Name | 2-methyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyridine-1-thione |
|---|---|
| PubChem CID | 167036996 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-methyl-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[c]pyridine-1-thione |
| SMILES | CN1CCC2CCCC2C1=S |
| InChI | InChI=1S/C9H15NS/c1-10-6-5-7-3-2-4-8(7)9(10)11/h7-8H,2-6H2,1H3 |
| InChIKey | QWPJADWVXHNSKA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|