C27H26N6O2S — CID 167040153
N-[4-[[4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]sulfanylmethyl]phenyl]but-2-ynamide (PubChem CID 167040153) has the molecular formula C27H26N6O2S and a molecular weight of 498.61 g/mol. Its IUPAC name is N-[4-[[4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]sulfanylmethyl]phenyl]but-2-ynamide.
| Compound Name | N-[4-[[4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]sulfanylmethyl]phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 167040153 |
| Molecular Formula | C27H26N6O2S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-[4-[[4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]sulfanylmethyl]phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1ccc(CSNc2ccc(-c3cc4c(N5CCOCC5)ncnc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C27H26N6O2S/c1-2-3-25(34)30-21-8-4-19(5-9-21)17-36-32-22-10-6-20(7-11-22)24-16-23-26(31-24)28-18-29-27(23)33-12-14-35-15-13-33/h4-11,16,18,32H,12-15,17H2,1H3,(H,30,34)(H,28,29,31) |
| InChIKey | DYFAVUFJLNSZEY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|