C8H12N2O2 — CID 167041231
4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethanediol (PubChem CID 167041231) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethanediol.
| Compound Name | 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethanediol |
|---|---|
| PubChem CID | 167041231 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethanediol |
| SMILES | OC(O)c1cc2n(n1)CCCC2 |
| InChI | InChI=1S/C8H12N2O2/c11-8(12)7-5-6-3-1-2-4-10(6)9-7/h5,8,11-12H,1-4H2 |
| InChIKey | VAWVBBYYBXHLNX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|