About ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole
ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (PubChem CID 177243494) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
Analyze ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The IUPAC name of ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (CID 177243494) is ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole.
What is the SMILES notation for ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The canonical SMILES for ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is CC.CC.Cc1cc2n(n1)CCC2.
What is the InChIKey of ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
The InChIKey is IPIVMCNBRXRNDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.2C2H6/c1-6-5-7-3-2-4-9(7)8-6;2*1-2/h5H,2-4H2,1H3;2*1-2H3.
What are the key properties of ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole?
ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole has a molecular weight of 182.31 g/mol, XLogP of 3.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole is sourced from PubChem (CID 177243494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).