C20H25F3N2O — CID 167042166
(5R)-5-[3-(1-methoxyethenyl)-2-methylindol-1-yl]-N-(2,2,2-trifluoroethyl)hex-1-en-2-amine (PubChem CID 167042166) has the molecular formula C20H25F3N2O and a molecular weight of 366.43 g/mol. Its IUPAC name is (5R)-5-[3-(1-methoxyethenyl)-2-methylindol-1-yl]-N-(2,2,2-trifluoroethyl)hex-1-en-2-amine.
| Compound Name | (5R)-5-[3-(1-methoxyethenyl)-2-methylindol-1-yl]-N-(2,2,2-trifluoroethyl)hex-1-en-2-amine |
|---|---|
| PubChem CID | 167042166 |
| Molecular Formula | C20H25F3N2O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (5R)-5-[3-(1-methoxyethenyl)-2-methylindol-1-yl]-N-(2,2,2-trifluoroethyl)hex-1-en-2-amine |
| SMILES | C=C(CC[C@@H](C)n1c(C)c(C(=C)OC)c2ccccc21)NCC(F)(F)F |
| InChI | InChI=1S/C20H25F3N2O/c1-13(24-12-20(21,22)23)10-11-14(2)25-15(3)19(16(4)26-5)17-8-6-7-9-18(17)25/h6-9,14,24H,1,4,10-12H2,2-3,5H3/t14-/m1/s1 |
| InChIKey | WFHDOAWVWMGBEH-CQSZACIVSA-N |
| XLogP | 5.57 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|