C31H36F3NO4 — CID 167046125
cis-(1R,2S)-2-[3-[[(3Z,5E)-7,8-dimethyl-5-(3-phenylpropoxy)nona-3,5-dienoyl]amino]-4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 167046125) has the molecular formula C31H36F3NO4 and a molecular weight of 543.63 g/mol. Its IUPAC name is cis-(1R,2S)-2-[3-[[(3Z,5E)-7,8-dimethyl-5-(3-phenylpropoxy)nona-3,5-dienoyl]amino]-4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[3-[[(3Z,5E)-7,8-dimethyl-5-(3-phenylpropoxy)nona-3,5-dienoyl]amino]-4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 167046125 |
| Molecular Formula | C31H36F3NO4 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | cis-(1R,2S)-2-[3-[[(3Z,5E)-7,8-dimethyl-5-(3-phenylpropoxy)nona-3,5-dienoyl]amino]-4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)C(C)/C=C(\C=C/CC(=O)Nc1cc([C@H]2C[C@H]2C(=O)O)ccc1C(F)(F)F)OCCCc1ccccc1 |
| InChI | InChI=1S/C31H36F3NO4/c1-20(2)21(3)17-24(39-16-8-11-22-9-5-4-6-10-22)12-7-13-29(36)35-28-18-23(25-19-26(25)30(37)38)14-15-27(28)31(32,33)34/h4-7,9-10,12,14-15,17-18,20-21,25-26H,8,11,13,16,19H2,1-3H3,(H,35,36)(H,37,38)/b12-7-,24-17+/t21?,25-,26-/m1/s1 |
| InChIKey | FHLVMQJIUJEWOD-IMLQXNNWSA-N |
| XLogP | 7.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|