C26H30F3NO4 — CID 155748127
cis-(1R,2S)-2-[3-[(4-hexoxy-2,6-dimethylbenzoyl)amino]-4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 155748127) has the molecular formula C26H30F3NO4 and a molecular weight of 477.52 g/mol. Its IUPAC name is cis-(1R,2S)-2-[3-[(4-hexoxy-2,6-dimethylbenzoyl)amino]-4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[3-[(4-hexoxy-2,6-dimethylbenzoyl)amino]-4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155748127 |
| Molecular Formula | C26H30F3NO4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | cis-(1R,2S)-2-[3-[(4-hexoxy-2,6-dimethylbenzoyl)amino]-4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CCCCCCOc1cc(C)c(C(=O)Nc2cc([C@H]3C[C@H]3C(=O)O)ccc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C26H30F3NO4/c1-4-5-6-7-10-34-18-11-15(2)23(16(3)12-18)24(31)30-22-13-17(19-14-20(19)25(32)33)8-9-21(22)26(27,28)29/h8-9,11-13,19-20H,4-7,10,14H2,1-3H3,(H,30,31)(H,32,33)/t19-,20-/m1/s1 |
| InChIKey | MOSUFBSYJWSCEC-WOJBJXKFSA-N |
| XLogP | 6.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|