C36H45N7O6 — CID 167048270
N-[4-amino-5-[[1-[2-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]ethyl]piperidin-4-yl]iminomethyl]-2-(2-hydroxypropan-2-yl)phenyl]formamide (PubChem CID 167048270) has the molecular formula C36H45N7O6 and a molecular weight of 671.80 g/mol. Its IUPAC name is N-[4-amino-5-[[1-[2-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]ethyl]piperidin-4-yl]iminomethyl]-2-(2-hydroxypropan-2-yl)phenyl]formamide.
| Compound Name | N-[4-amino-5-[[1-[2-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]ethyl]piperidin-4-yl]iminomethyl]-2-(2-hydroxypropan-2-yl)phenyl]formamide |
|---|---|
| PubChem CID | 167048270 |
| Molecular Formula | C36H45N7O6 |
| Molecular Weight | 671.80 g/mol |
| Exact Mass | 671.34 |
| IUPAC Name | N-[4-amino-5-[[1-[2-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperidin-4-yl]ethyl]piperidin-4-yl]iminomethyl]-2-(2-hydroxypropan-2-yl)phenyl]formamide |
| SMILES | CC(C)(O)c1cc(N)c(/C=N/C2CCN(CCC3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1NC=O |
| InChI | InChI=1S/C36H45N7O6/c1-36(2,49)28-19-29(37)23(17-30(28)39-21-44)20-38-24-10-13-41(14-11-24)12-7-22-8-15-42(16-9-22)25-3-4-26-27(18-25)35(48)43(34(26)47)31-5-6-32(45)40-33(31)46/h3-4,17-22,24,31,49H,5-16,37H2,1-2H3,(H,39,44)(H,40,45,46)/b38-20+ |
| InChIKey | NEZWWGCGBUDVAP-CHSHITCJSA-N |
| XLogP | 2.66 |
| TPSA | 177.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.80 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|