C34H46N6O4 — CID 155583317
2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[1-[1-[(3Z)-penta-1,3-dien-2-yl]piperidin-4-yl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 155583317) has the molecular formula C34H46N6O4 and a molecular weight of 602.78 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[1-[1-[(3Z)-penta-1,3-dien-2-yl]piperidin-4-yl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[1-[1-[(3Z)-penta-1,3-dien-2-yl]piperidin-4-yl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155583317 |
| Molecular Formula | C34H46N6O4 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[1-[1-[(3Z)-penta-1,3-dien-2-yl]piperidin-4-yl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | C=C(/C=C\C)N1CCC(N2CCC(CCN3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)CC1 |
| InChI | InChI=1S/C34H46N6O4/c1-3-4-24(2)37-17-12-26(13-18-37)38-15-10-25(11-16-38)9-14-36-19-21-39(22-20-36)27-5-6-28-29(23-27)34(44)40(33(28)43)30-7-8-31(41)35-32(30)42/h3-6,23,25-26,30H,2,7-22H2,1H3,(H,35,41,42)/b4-3- |
| InChIKey | WNWXSKCJXCXREJ-ARJAWSKDSA-N |
| XLogP | 2.87 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|