C8H15NO2S4 — CID 167049479
1-[dithiocarboxy(2-hydroxypropyl)amino]propan-2-yloxymethanedithioic acid (PubChem CID 167049479) has the molecular formula C8H15NO2S4 and a molecular weight of 285.48 g/mol. Its IUPAC name is 1-[dithiocarboxy(2-hydroxypropyl)amino]propan-2-yloxymethanedithioic acid.
| Compound Name | 1-[dithiocarboxy(2-hydroxypropyl)amino]propan-2-yloxymethanedithioic acid |
|---|---|
| PubChem CID | 167049479 |
| Molecular Formula | C8H15NO2S4 |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 1-[dithiocarboxy(2-hydroxypropyl)amino]propan-2-yloxymethanedithioic acid |
| SMILES | CC(O)CN(CC(C)OC(=S)S)C(=S)S |
| InChI | InChI=1S/C8H15NO2S4/c1-5(10)3-9(7(12)13)4-6(2)11-8(14)15/h5-6,10H,3-4H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | QSBBKEDWTINGNE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|